C8H5F11O — CID 12662703
3-ethoxy-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene (PubChem CID 12662703) has the molecular formula C8H5F11O and a molecular weight of 326.11 g/mol. Its IUPAC name is 3-ethoxy-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene.
| Compound Name | 3-ethoxy-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 12662703 |
| Molecular Formula | C8H5F11O |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 3-ethoxy-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene |
| SMILES | CCOC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F11O/c1-2-20-4(5(9,10)8(17,18)19)3(6(11,12)13)7(14,15)16/h2H2,1H3 |
| InChIKey | MDVMZSADXOXENA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|