C8H8F6O2 — CID 101227617
5-ethoxy-1,1,1-trifluoro-2-(trifluoromethyl)pent-2-en-3-olate (PubChem CID 101227617) has the molecular formula C8H8F6O2 and a molecular weight of 250.14 g/mol. Its IUPAC name is 5-ethoxy-1,1,1-trifluoro-2-(trifluoromethyl)pent-2-en-3-olate.
| Compound Name | 5-ethoxy-1,1,1-trifluoro-2-(trifluoromethyl)pent-2-en-3-olate |
|---|---|
| PubChem CID | 101227617 |
| Molecular Formula | C8H8F6O2 |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 5-ethoxy-1,1,1-trifluoro-2-(trifluoromethyl)pent-2-en-3-olate |
| SMILES | CCO[CH+]CC([O-])=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8F6O2/c1-2-16-4-3-5(15)6(7(9,10)11)8(12,13)14/h4H,2-3H2,1H3 |
| InChIKey | CEONENLMDOMHMM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|