C8H4F12O — CID 23233564
1,1,1,5,5,5-hexafluoro-3-methoxy-2,4-bis(trifluoromethyl)pent-2-ene (PubChem CID 23233564) has the molecular formula C8H4F12O and a molecular weight of 344.10 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-3-methoxy-2,4-bis(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,5,5,5-hexafluoro-3-methoxy-2,4-bis(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 23233564 |
| Molecular Formula | C8H4F12O |
| Molecular Weight | 344.10 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-3-methoxy-2,4-bis(trifluoromethyl)pent-2-ene |
| SMILES | COC(=C(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4F12O/c1-21-2(3(5(9,10)11)6(12,13)14)4(7(15,16)17)8(18,19)20/h3H,1H3 |
| InChIKey | WGLNBQNKDULALL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.10 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|