C9H5F13O — CID 13267237
3-ethoxy-1,1,1,4,4,5,5,6,6,6-decafluoro-2-(trifluoromethyl)hex-2-ene (PubChem CID 13267237) has the molecular formula C9H5F13O and a molecular weight of 376.11 g/mol. Its IUPAC name is 3-ethoxy-1,1,1,4,4,5,5,6,6,6-decafluoro-2-(trifluoromethyl)hex-2-ene.
| Compound Name | 3-ethoxy-1,1,1,4,4,5,5,6,6,6-decafluoro-2-(trifluoromethyl)hex-2-ene |
|---|---|
| PubChem CID | 13267237 |
| Molecular Formula | C9H5F13O |
| Molecular Weight | 376.11 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 3-ethoxy-1,1,1,4,4,5,5,6,6,6-decafluoro-2-(trifluoromethyl)hex-2-ene |
| SMILES | CCOC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F13O/c1-2-23-4(3(6(12,13)14)7(15,16)17)5(10,11)8(18,19)9(20,21)22/h2H2,1H3 |
| InChIKey | TUHBSKPBTSNIMG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.11 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|