C11H8F14O — CID 170698896
1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)-3-(5,5,5-trifluoropentoxy)pent-2-ene (PubChem CID 170698896) has the molecular formula C11H8F14O and a molecular weight of 422.16 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)-3-(5,5,5-trifluoropentoxy)pent-2-ene.
| Compound Name | 1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)-3-(5,5,5-trifluoropentoxy)pent-2-ene |
|---|---|
| PubChem CID | 170698896 |
| Molecular Formula | C11H8F14O |
| Molecular Weight | 422.16 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)-3-(5,5,5-trifluoropentoxy)pent-2-ene |
| SMILES | FC(F)(F)CCCCOC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H8F14O/c12-7(13,14)3-1-2-4-26-6(8(15,16)11(23,24)25)5(9(17,18)19)10(20,21)22/h1-4H2 |
| InChIKey | NDXCOQHWULSIJA-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.16 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|