C8H2F14O — CID 170693713
1,1,1,4,4,5,5,5-octafluoro-3-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)pent-2-ene (PubChem CID 170693713) has the molecular formula C8H2F14O and a molecular weight of 380.08 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,5-octafluoro-3-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,4,4,5,5,5-octafluoro-3-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 170693713 |
| Molecular Formula | C8H2F14O |
| Molecular Weight | 380.08 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 1,1,1,4,4,5,5,5-octafluoro-3-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)pent-2-ene |
| SMILES | FC(F)(F)COC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F14O/c9-4(10,11)1-23-3(5(12,13)8(20,21)22)2(6(14,15)16)7(17,18)19/h1H2 |
| InChIKey | DRQPZWCIIKKHEC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.08 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|