C27H22ClF2NO — CID 16743588
4-[4-[4-chloro-1,1-bis(4-fluorophenyl)but-1-en-2-yl]phenyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 16743588) has the molecular formula C27H22ClF2NO and a molecular weight of 449.93 g/mol. Its IUPAC name is 4-[4-[4-chloro-1,1-bis(4-fluorophenyl)but-1-en-2-yl]phenyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[4-[4-chloro-1,1-bis(4-fluorophenyl)but-1-en-2-yl]phenyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 16743588 |
| Molecular Formula | C27H22ClF2NO |
| Molecular Weight | 449.93 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 4-[4-[4-chloro-1,1-bis(4-fluorophenyl)but-1-en-2-yl]phenyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1ccc(C(CCCl)=C(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H22ClF2NO/c1-17-26(18(2)32-31-17)20-5-3-19(4-6-20)25(15-16-28)27(21-7-11-23(29)12-8-21)22-9-13-24(30)14-10-22/h3-14H,15-16H2,1-2H3 |
| InChIKey | ATQFVQKDJVZORJ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.93 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|