C15H21N3O3 — CID 167436725
tert-butyl N-[4-(6-oxo-1H-pyrimidin-4-yl)cyclohex-3-en-1-yl]carbamate (PubChem CID 167436725) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is tert-butyl N-[4-(6-oxo-1H-pyrimidin-4-yl)cyclohex-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[4-(6-oxo-1H-pyrimidin-4-yl)cyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 167436725 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | tert-butyl N-[4-(6-oxo-1H-pyrimidin-4-yl)cyclohex-3-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC=C(c2cc(=O)[nH]cn2)CC1 |
| InChI | InChI=1S/C15H21N3O3/c1-15(2,3)21-14(20)18-11-6-4-10(5-7-11)12-8-13(19)17-9-16-12/h4,8-9,11H,5-7H2,1-3H3,(H,18,20)(H,16,17,19) |
| InChIKey | OVYNCAOIVWAWPW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |