C25H31N3O4S — CID 175377596
tert-butyl N-[4-[4-(4-amino-2-cyclopropylsulfonylphenyl)-2-pyridinyl]cyclohex-3-en-1-yl]carbamate (PubChem CID 175377596) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is tert-butyl N-[4-[4-(4-amino-2-cyclopropylsulfonylphenyl)-2-pyridinyl]cyclohex-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[4-[4-(4-amino-2-cyclopropylsulfonylphenyl)-2-pyridinyl]cyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 175377596 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | tert-butyl N-[4-[4-(4-amino-2-cyclopropylsulfonylphenyl)-2-pyridinyl]cyclohex-3-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC=C(c2cc(-c3ccc(N)cc3S(=O)(=O)C3CC3)ccn2)CC1 |
| InChI | InChI=1S/C25H31N3O4S/c1-25(2,3)32-24(29)28-19-7-4-16(5-8-19)22-14-17(12-13-27-22)21-11-6-18(26)15-23(21)33(30,31)20-9-10-20/h4,6,11-15,19-20H,5,7-10,26H2,1-3H3,(H,28,29) |
| InChIKey | ILINQYFGYVZLRK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|