About (2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate
(2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate (PubChem CID 167436986) has the molecular formula C14H25NO6
and a molecular weight of 303.36 g/mol. Its IUPAC name is (2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate.
Molecular Properties
| Compound Name | (2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate |
| PubChem CID | 167436986 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | (2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate |
| SMILES | CC(C)CCCC(=O)OCNC(=O)OCOC(=O)C(C)C |
| InChI | InChI=1S/C14H25NO6/c1-10(2)6-5-7-12(16)19-8-15-14(18)21-9-20-13(17)11(3)4/h10-11H,5-9H2,1-4H3,(H,15,18) |
| InChIKey | LXWWYABJKMACEK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate?
The IUPAC name of (2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate (CID 167436986) is (2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate.
What is the SMILES notation for (2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate?
The canonical SMILES for (2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate is CC(C)CCCC(=O)OCNC(=O)OCOC(=O)C(C)C.
What is the InChIKey of (2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate?
The InChIKey is LXWWYABJKMACEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO6/c1-10(2)6-5-7-12(16)19-8-15-14(18)21-9-20-13(17)11(3)4/h10-11H,5-9H2,1-4H3,(H,15,18).
What are the key properties of (2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate?
(2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate has a molecular weight of 303.36 g/mol, XLogP of 2.20, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpropanoyloxymethoxycarbonylamino)methyl 5-methylhexanoate is sourced from PubChem (CID 167436986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).