C42H39N3O4S — CID 167437182
2-[4-[[4-[2-(4-trityloxyphenyl)propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]-1,2-thiazolidine 1,1-dioxide (PubChem CID 167437182) has the molecular formula C42H39N3O4S and a molecular weight of 681.86 g/mol. Its IUPAC name is 2-[4-[[4-[2-(4-trityloxyphenyl)propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-[4-[[4-[2-(4-trityloxyphenyl)propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 167437182 |
| Molecular Formula | C42H39N3O4S |
| Molecular Weight | 681.86 g/mol |
| Exact Mass | 681.27 |
| IUPAC Name | 2-[4-[[4-[2-(4-trityloxyphenyl)propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]-1,2-thiazolidine 1,1-dioxide |
| SMILES | CC(C)(c1ccc(OCc2ccnc(N3CCCS3(=O)=O)n2)cc1)c1ccc(OC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H39N3O4S/c1-41(2,32-19-23-38(24-20-32)48-31-37-27-28-43-40(44-37)45-29-12-30-50(45,46)47)33-21-25-39(26-22-33)49-42(34-13-6-3-7-14-34,35-15-8-4-9-16-35)36-17-10-5-11-18-36/h3-11,13-28H,12,29-31H2,1-2H3 |
| InChIKey | NCANBJBRGHYDOH-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.86 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|