C38H38O3S — CID 156534471
1-methylsulfanyl-3-[4-[2-(4-trityloxyphenyl)propan-2-yl]phenoxy]propan-2-ol (PubChem CID 156534471) has the molecular formula C38H38O3S and a molecular weight of 574.79 g/mol. Its IUPAC name is 1-methylsulfanyl-3-[4-[2-(4-trityloxyphenyl)propan-2-yl]phenoxy]propan-2-ol.
| Compound Name | 1-methylsulfanyl-3-[4-[2-(4-trityloxyphenyl)propan-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 156534471 |
| Molecular Formula | C38H38O3S |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 1-methylsulfanyl-3-[4-[2-(4-trityloxyphenyl)propan-2-yl]phenoxy]propan-2-ol |
| SMILES | CSCC(O)COc1ccc(C(C)(C)c2ccc(OC(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C38H38O3S/c1-37(2,29-19-23-35(24-20-29)40-27-34(39)28-42-3)30-21-25-36(26-22-30)41-38(31-13-7-4-8-14-31,32-15-9-5-10-16-32)33-17-11-6-12-18-33/h4-26,34,39H,27-28H2,1-3H3 |
| InChIKey | OVYTZBCXMIBGEZ-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|