C17H20O5S — CID 16743797
[(2R,3S,6R)-3-acetyloxy-6-(4-methylphenyl)sulfanyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 16743797) has the molecular formula C17H20O5S and a molecular weight of 336.41 g/mol. Its IUPAC name is [(2R,3S,6R)-3-acetyloxy-6-(4-methylphenyl)sulfanyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-3-acetyloxy-6-(4-methylphenyl)sulfanyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 16743797 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | [(2R,3S,6R)-3-acetyloxy-6-(4-methylphenyl)sulfanyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Sc2ccc(C)cc2)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H20O5S/c1-11-4-6-14(7-5-11)23-17-9-8-15(21-13(3)19)16(22-17)10-20-12(2)18/h4-9,15-17H,10H2,1-3H3/t15-,16+,17+/m0/s1 |
| InChIKey | SATYZAHCHXAGIF-GVDBMIGSSA-N |
| XLogP | 2.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|