C12H14BrN3O2 — CID 167438492
ethyl 1-(2-aminoethyl)-6-bromopyrrolo[2,3-b]pyridine-2-carboxylate (PubChem CID 167438492) has the molecular formula C12H14BrN3O2 and a molecular weight of 312.17 g/mol. Its IUPAC name is ethyl 1-(2-aminoethyl)-6-bromopyrrolo[2,3-b]pyridine-2-carboxylate.
| Compound Name | ethyl 1-(2-aminoethyl)-6-bromopyrrolo[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 167438492 |
| Molecular Formula | C12H14BrN3O2 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | ethyl 1-(2-aminoethyl)-6-bromopyrrolo[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2ccc(Br)nc2n1CCN |
| InChI | InChI=1S/C12H14BrN3O2/c1-2-18-12(17)9-7-8-3-4-10(13)15-11(8)16(9)6-5-14/h3-4,7H,2,5-6,14H2,1H3 |
| InChIKey | JMFWQQFEMBOYBZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|