C19H32N2O4S — CID 167438530
ethyl 2-[2-(tert-butylsulfinylamino)-4-methylpentyl]-6-methoxypyridine-3-carboxylate (PubChem CID 167438530) has the molecular formula C19H32N2O4S and a molecular weight of 384.54 g/mol. Its IUPAC name is ethyl 2-[2-(tert-butylsulfinylamino)-4-methylpentyl]-6-methoxypyridine-3-carboxylate.
| Compound Name | ethyl 2-[2-(tert-butylsulfinylamino)-4-methylpentyl]-6-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 167438530 |
| Molecular Formula | C19H32N2O4S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | ethyl 2-[2-(tert-butylsulfinylamino)-4-methylpentyl]-6-methoxypyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(OC)nc1CC(CC(C)C)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C19H32N2O4S/c1-8-25-18(22)15-9-10-17(24-7)20-16(15)12-14(11-13(2)3)21-26(23)19(4,5)6/h9-10,13-14,21H,8,11-12H2,1-7H3 |
| InChIKey | JMIYSFKXDCSVIF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |