C17H33NO5Si — CID 16744022
(6R,7R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-7-(2-methoxyethoxymethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 16744022) has the molecular formula C17H33NO5Si and a molecular weight of 359.54 g/mol. Its IUPAC name is (6R,7R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-7-(2-methoxyethoxymethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (6R,7R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-7-(2-methoxyethoxymethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 16744022 |
| Molecular Formula | C17H33NO5Si |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (6R,7R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-7-(2-methoxyethoxymethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | COCCOCO[C@@H]1[C@H]2CCC(=O)N2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H33NO5Si/c1-17(2,3)24(5,6)23-14-11-18-13(7-8-15(18)19)16(14)22-12-21-10-9-20-4/h13-14,16H,7-12H2,1-6H3/t13-,14-,16-/m1/s1 |
| InChIKey | CFNMAFKZTOQWMQ-IIAWOOMASA-N |
| XLogP | 2.39 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|