C16H31NO5Si — CID 25105228
(5R,6R,7S,8R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-7-(methoxymethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 25105228) has the molecular formula C16H31NO5Si and a molecular weight of 345.51 g/mol. Its IUPAC name is (5R,6R,7S,8R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-7-(methoxymethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (5R,6R,7S,8R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-7-(methoxymethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 25105228 |
| Molecular Formula | C16H31NO5Si |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | (5R,6R,7S,8R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-7-(methoxymethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | COCO[C@@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)N2C(=O)CC[C@H]12 |
| InChI | InChI=1S/C16H31NO5Si/c1-16(2,3)23(5,6)22-9-12-14(19)15(21-10-20-4)11-7-8-13(18)17(11)12/h11-12,14-15,19H,7-10H2,1-6H3/t11-,12-,14-,15+/m1/s1 |
| InChIKey | DWXUBRFGFHCUSJ-GBOPCIDUSA-N |
| XLogP | 1.73 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|