C17H31NO4Si — CID 72196809
(4aS,5R,5aS,9aR)-5-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethyl-4a,5,5a,6,7,9a-hexahydro-1H-[1,3]dioxino[4,5-b]pyrrolizin-8-one (PubChem CID 72196809) has the molecular formula C17H31NO4Si and a molecular weight of 341.50 g/mol. Its IUPAC name is (4aS,5R,5aS,9aR)-5-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethyl-4a,5,5a,6,7,9a-hexahydro-1H-[1,3]dioxino[4,5-b]pyrrolizin-8-one.
| Compound Name | (4aS,5R,5aS,9aR)-5-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethyl-4a,5,5a,6,7,9a-hexahydro-1H-[1,3]dioxino[4,5-b]pyrrolizin-8-one |
|---|---|
| PubChem CID | 72196809 |
| Molecular Formula | C17H31NO4Si |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (4aS,5R,5aS,9aR)-5-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethyl-4a,5,5a,6,7,9a-hexahydro-1H-[1,3]dioxino[4,5-b]pyrrolizin-8-one |
| SMILES | CC1(OC[C@@H]2[C@H](O1)[C@@H]([C@H]3N2C(=O)CC3)O[Si](C)(C)C(C)(C)C)C |
| InChI | InChI=1S/C17H31NO4Si/c1-16(2,3)23(6,7)22-15-11-8-9-13(19)18(11)12-10-20-17(4,5)21-14(12)15/h11-12,14-15H,8-10H2,1-7H3/t11-,12+,14-,15+/m0/s1 |
| InChIKey | CYMIDIOSUZZLQK-MYZSUADSSA-N |
| XLogP | — |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | 499 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|