C34H64O4Si — CID 167440323
tris(2,6-dimethylheptan-4-yloxy)-(2-methoxyphenyl)silane (PubChem CID 167440323) has the molecular formula C34H64O4Si and a molecular weight of 564.97 g/mol. Its IUPAC name is tris(2,6-dimethylheptan-4-yloxy)-(2-methoxyphenyl)silane.
| Compound Name | tris(2,6-dimethylheptan-4-yloxy)-(2-methoxyphenyl)silane |
|---|---|
| PubChem CID | 167440323 |
| Molecular Formula | C34H64O4Si |
| Molecular Weight | 564.97 g/mol |
| Exact Mass | 564.46 |
| IUPAC Name | tris(2,6-dimethylheptan-4-yloxy)-(2-methoxyphenyl)silane |
| SMILES | COc1ccccc1[Si](OC(CC(C)C)CC(C)C)(OC(CC(C)C)CC(C)C)OC(CC(C)C)CC(C)C |
| InChI | InChI=1S/C34H64O4Si/c1-24(2)18-30(19-25(3)4)36-39(34-17-15-14-16-33(34)35-13,37-31(20-26(5)6)21-27(7)8)38-32(22-28(9)10)23-29(11)12/h14-17,24-32H,18-23H2,1-13H3 |
| InChIKey | JHDIKNZOPIDSOB-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.97 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|