C28H22F4N6O3S — CID 167440903
N-[5-[[2-(cyclopropanecarbonylamino)-1,3-benzothiazol-6-yl]oxy]-2-fluorophenyl]-3-[[4-(trifluoromethyl)phenyl]methyl]-1,2-dihydro-1,2,4-triazole-3-carboxamide (PubChem CID 167440903) has the molecular formula C28H22F4N6O3S and a molecular weight of 598.58 g/mol. Its IUPAC name is N-[5-[[2-(cyclopropanecarbonylamino)-1,3-benzothiazol-6-yl]oxy]-2-fluorophenyl]-3-[[4-(trifluoromethyl)phenyl]methyl]-1,2-dihydro-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[5-[[2-(cyclopropanecarbonylamino)-1,3-benzothiazol-6-yl]oxy]-2-fluorophenyl]-3-[[4-(trifluoromethyl)phenyl]methyl]-1,2-dihydro-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 167440903 |
| Molecular Formula | C28H22F4N6O3S |
| Molecular Weight | 598.58 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | N-[5-[[2-(cyclopropanecarbonylamino)-1,3-benzothiazol-6-yl]oxy]-2-fluorophenyl]-3-[[4-(trifluoromethyl)phenyl]methyl]-1,2-dihydro-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(Nc1nc2ccc(Oc3ccc(F)c(NC(=O)C4(Cc5ccc(C(F)(F)F)cc5)N=CNN4)c3)cc2s1)C1CC1 |
| InChI | InChI=1S/C28H22F4N6O3S/c29-20-9-7-18(41-19-8-10-21-23(12-19)42-26(36-21)37-24(39)16-3-4-16)11-22(20)35-25(40)27(33-14-34-38-27)13-15-1-5-17(6-2-15)28(30,31)32/h1-2,5-12,14,16,38H,3-4,13H2,(H,33,34)(H,35,40)(H,36,37,39) |
| InChIKey | QXLLCRYXBLBYKF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |