C28H25FN6O3S — CID 167440915
N-[5-[[2-(cyclopropanecarbonylamino)-1,3-benzothiazol-6-yl]oxy]-2-fluorophenyl]-3-[(3-methylphenyl)methyl]-1,2-dihydro-1,2,4-triazole-3-carboxamide (PubChem CID 167440915) has the molecular formula C28H25FN6O3S and a molecular weight of 544.61 g/mol. Its IUPAC name is N-[5-[[2-(cyclopropanecarbonylamino)-1,3-benzothiazol-6-yl]oxy]-2-fluorophenyl]-3-[(3-methylphenyl)methyl]-1,2-dihydro-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[5-[[2-(cyclopropanecarbonylamino)-1,3-benzothiazol-6-yl]oxy]-2-fluorophenyl]-3-[(3-methylphenyl)methyl]-1,2-dihydro-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 167440915 |
| Molecular Formula | C28H25FN6O3S |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | N-[5-[[2-(cyclopropanecarbonylamino)-1,3-benzothiazol-6-yl]oxy]-2-fluorophenyl]-3-[(3-methylphenyl)methyl]-1,2-dihydro-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1cccc(CC2(C(=O)Nc3cc(Oc4ccc5nc(NC(=O)C6CC6)sc5c4)ccc3F)N=CNN2)c1 |
| InChI | InChI=1S/C28H25FN6O3S/c1-16-3-2-4-17(11-16)14-28(30-15-31-35-28)26(37)32-23-12-19(7-9-21(23)29)38-20-8-10-22-24(13-20)39-27(33-22)34-25(36)18-5-6-18/h2-4,7-13,15,18,35H,5-6,14H2,1H3,(H,30,31)(H,32,37)(H,33,34,36) |
| InChIKey | UCCPAIMKMDVITF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |