C13H18F2O4S — CID 16744211
(3,3-diethoxy-1,1-difluoropropyl)sulfonylbenzene (PubChem CID 16744211) has the molecular formula C13H18F2O4S and a molecular weight of 308.35 g/mol. Its IUPAC name is (3,3-diethoxy-1,1-difluoropropyl)sulfonylbenzene.
| Compound Name | (3,3-diethoxy-1,1-difluoropropyl)sulfonylbenzene |
|---|---|
| PubChem CID | 16744211 |
| Molecular Formula | C13H18F2O4S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (3,3-diethoxy-1,1-difluoropropyl)sulfonylbenzene |
| SMILES | CCOC(CC(F)(F)S(=O)(=O)c1ccccc1)OCC |
| InChI | InChI=1S/C13H18F2O4S/c1-3-18-12(19-4-2)10-13(14,15)20(16,17)11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3 |
| InChIKey | SXBHPXZIPCLWEK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|