C15H24N2O2 — CID 167447350
2-methoxy-1,4-dimethylbenzene;N-(1-methylpyrrolidin-3-yl)formamide (PubChem CID 167447350) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-methoxy-1,4-dimethylbenzene;N-(1-methylpyrrolidin-3-yl)formamide.
| Compound Name | 2-methoxy-1,4-dimethylbenzene;N-(1-methylpyrrolidin-3-yl)formamide |
|---|---|
| PubChem CID | 167447350 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-methoxy-1,4-dimethylbenzene;N-(1-methylpyrrolidin-3-yl)formamide |
| SMILES | CN1CCC(NC=O)C1.COc1cc(C)ccc1C |
| InChI | InChI=1S/C9H12O.C6H12N2O/c1-7-4-5-8(2)9(6-7)10-3;1-8-3-2-6(4-8)7-5-9/h4-6H,1-3H3;5-6H,2-4H2,1H3,(H,7,9) |
| InChIKey | BUHSMHYXRFZFHB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|