C24H33N3O3 — CID 142457699
1,4-dimethyl-2-[(2-methylpropan-2-yl)oxy]benzene;N-[1-(pyridine-4-carbonyl)piperidin-4-yl]formamide (PubChem CID 142457699) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 1,4-dimethyl-2-[(2-methylpropan-2-yl)oxy]benzene;N-[1-(pyridine-4-carbonyl)piperidin-4-yl]formamide.
| Compound Name | 1,4-dimethyl-2-[(2-methylpropan-2-yl)oxy]benzene;N-[1-(pyridine-4-carbonyl)piperidin-4-yl]formamide |
|---|---|
| PubChem CID | 142457699 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 1,4-dimethyl-2-[(2-methylpropan-2-yl)oxy]benzene;N-[1-(pyridine-4-carbonyl)piperidin-4-yl]formamide |
| SMILES | Cc1ccc(C)c(OC(C)(C)C)c1.O=CNC1CCN(C(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C12H15N3O2.C12H18O/c16-9-14-11-3-7-15(8-4-11)12(17)10-1-5-13-6-2-10;1-9-6-7-10(2)11(8-9)13-12(3,4)5/h1-2,5-6,9,11H,3-4,7-8H2,(H,14,16);6-8H,1-5H3 |
| InChIKey | VXGNAGJXCFHMDD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|