C25H33N3O2S — CID 142458092
N-[1-(4-cyanophenyl)sulfanylpiperidin-4-yl]formamide;1,4-dimethyl-2-[(2-methylpropan-2-yl)oxy]benzene (PubChem CID 142458092) has the molecular formula C25H33N3O2S and a molecular weight of 439.63 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)sulfanylpiperidin-4-yl]formamide;1,4-dimethyl-2-[(2-methylpropan-2-yl)oxy]benzene.
| Compound Name | N-[1-(4-cyanophenyl)sulfanylpiperidin-4-yl]formamide;1,4-dimethyl-2-[(2-methylpropan-2-yl)oxy]benzene |
|---|---|
| PubChem CID | 142458092 |
| Molecular Formula | C25H33N3O2S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N-[1-(4-cyanophenyl)sulfanylpiperidin-4-yl]formamide;1,4-dimethyl-2-[(2-methylpropan-2-yl)oxy]benzene |
| SMILES | Cc1ccc(C)c(OC(C)(C)C)c1.N#Cc1ccc(SN2CCC(NC=O)CC2)cc1 |
| InChI | InChI=1S/C13H15N3OS.C12H18O/c14-9-11-1-3-13(4-2-11)18-16-7-5-12(6-8-16)15-10-17;1-9-6-7-10(2)11(8-9)13-12(3,4)5/h1-4,10,12H,5-8H2,(H,15,17);6-8H,1-5H3 |
| InChIKey | MJYRLMGIBQIEDG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|