C18H30N4O4 — CID 167448063
3-butan-2-yl-1-[[1-[2-(2-propoxyethoxy)ethyl]triazol-4-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 167448063) has the molecular formula C18H30N4O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-butan-2-yl-1-[[1-[2-(2-propoxyethoxy)ethyl]triazol-4-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 3-butan-2-yl-1-[[1-[2-(2-propoxyethoxy)ethyl]triazol-4-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 167448063 |
| Molecular Formula | C18H30N4O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 3-butan-2-yl-1-[[1-[2-(2-propoxyethoxy)ethyl]triazol-4-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | CCCOCCOCCn1cc(CN2C(=O)CC(C(C)CC)C2=O)nn1 |
| InChI | InChI=1S/C18H30N4O4/c1-4-7-25-9-10-26-8-6-21-12-15(19-20-21)13-22-17(23)11-16(18(22)24)14(3)5-2/h12,14,16H,4-11,13H2,1-3H3 |
| InChIKey | ITHFXLBACRJFAZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|