C16H30N4O5S — CID 158632737
4-[[1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]triazol-4-yl]methyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 158632737) has the molecular formula C16H30N4O5S and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-[[1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]triazol-4-yl]methyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[[1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]triazol-4-yl]methyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 158632737 |
| Molecular Formula | C16H30N4O5S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-[[1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]triazol-4-yl]methyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | CCCOCCOCCOCCn1cc(CN2CCS(=O)(=O)CC2)nn1 |
| InChI | InChI=1S/C16H30N4O5S/c1-2-6-23-8-10-25-11-9-24-7-3-20-15-16(17-18-20)14-19-4-12-26(21,22)13-5-19/h15H,2-14H2,1H3 |
| InChIKey | LHELRRLDUFBJRO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|