C16H29N5O7S — CID 146315804
2-[2-[2-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]ethylcarbamic acid (PubChem CID 146315804) has the molecular formula C16H29N5O7S and a molecular weight of 435.50 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 146315804 |
| Molecular Formula | C16H29N5O7S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-[2-[2-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOCCOCCOCCn1cc(CN2CCS(=O)(=O)CC2)nn1 |
| InChI | InChI=1S/C16H29N5O7S/c22-16(23)17-1-5-26-7-9-28-10-8-27-6-2-21-14-15(18-19-21)13-20-3-11-29(24,25)12-4-20/h14,17H,1-13H2,(H,22,23) |
| InChIKey | QMXCDGPBDFLBEF-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 145.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|