C10H10N2OS — CID 167449107
[4-(pyridin-4-ylmethyl)-1,3-thiazol-2-yl]methanol (PubChem CID 167449107) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is [4-(pyridin-4-ylmethyl)-1,3-thiazol-2-yl]methanol.
| Compound Name | [4-(pyridin-4-ylmethyl)-1,3-thiazol-2-yl]methanol |
|---|---|
| PubChem CID | 167449107 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | [4-(pyridin-4-ylmethyl)-1,3-thiazol-2-yl]methanol |
| SMILES | OCc1nc(Cc2ccncc2)cs1 |
| InChI | InChI=1S/C10H10N2OS/c13-6-10-12-9(7-14-10)5-8-1-3-11-4-2-8/h1-4,7,13H,5-6H2 |
| InChIKey | WQBLCXZNCZKVDW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |