C10H8N2OS — CID 62551222
2-(pyridin-4-ylmethyl)-1,3-thiazole-4-carbaldehyde (PubChem CID 62551222) has the molecular formula C10H8N2OS and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-(pyridin-4-ylmethyl)-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-(pyridin-4-ylmethyl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 62551222 |
| Molecular Formula | C10H8N2OS |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 2-(pyridin-4-ylmethyl)-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1csc(Cc2ccncc2)n1 |
| InChI | InChI=1S/C10H8N2OS/c13-6-9-7-14-10(12-9)5-8-1-3-11-4-2-8/h1-4,6-7H,5H2 |
| InChIKey | DSQNSXKWUNJOTN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|