C9H16N2OS — CID 142947803
2-[(dimethylamino)methyl]-1,3-thiazole-4-carbaldehyde;ethane (PubChem CID 142947803) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-1,3-thiazole-4-carbaldehyde;ethane.
| Compound Name | 2-[(dimethylamino)methyl]-1,3-thiazole-4-carbaldehyde;ethane |
|---|---|
| PubChem CID | 142947803 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-[(dimethylamino)methyl]-1,3-thiazole-4-carbaldehyde;ethane |
| SMILES | CC.CN(C)Cc1nc(C=O)cs1 |
| InChI | InChI=1S/C7H10N2OS.C2H6/c1-9(2)3-7-8-6(4-10)5-11-7;1-2/h4-5H,3H2,1-2H3;1-2H3 |
| InChIKey | WKXUTECEDIXBFQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|