About ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide
ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide (PubChem CID 144755315) has the molecular formula C11H18N2O2S
and a molecular weight of 242.34 g/mol. Its IUPAC name is ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide.
Molecular Properties
| Compound Name | ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide |
| PubChem CID | 144755315 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide |
| SMILES | CC.CC(=O)NCCCc1nc(C=O)cs1 |
| InChI | InChI=1S/C9H12N2O2S.C2H6/c1-7(13)10-4-2-3-9-11-8(5-12)6-14-9;1-2/h5-6H,2-4H2,1H3,(H,10,13);1-2H3 |
| InChIKey | UNBXTSKCEZDZMO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide?
The IUPAC name of ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide (CID 144755315) is ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide.
What is the SMILES notation for ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide?
The canonical SMILES for ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide is CC.CC(=O)NCCCc1nc(C=O)cs1.
What is the InChIKey of ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide?
The InChIKey is UNBXTSKCEZDZMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S.C2H6/c1-7(13)10-4-2-3-9-11-8(5-12)6-14-9;1-2/h5-6H,2-4H2,1H3,(H,10,13);1-2H3.
What are the key properties of ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide?
ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide has a molecular weight of 242.34 g/mol, XLogP of 2.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[3-(4-formyl-1,3-thiazol-2-yl)propyl]acetamide is sourced from PubChem (CID 144755315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).