C11H7Cl2NOS — CID 60998346
2-[(2,4-dichlorophenyl)methyl]-1,3-thiazole-4-carbaldehyde (PubChem CID 60998346) has the molecular formula C11H7Cl2NOS and a molecular weight of 272.16 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 60998346 |
| Molecular Formula | C11H7Cl2NOS |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1csc(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C11H7Cl2NOS/c12-8-2-1-7(10(13)4-8)3-11-14-9(5-15)6-16-11/h1-2,4-6H,3H2 |
| InChIKey | ANNDKSZMGLCSQU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|