C11H8ClNOS2 — CID 66148273
2-[(3-chlorophenyl)sulfanylmethyl]-1,3-thiazole-4-carbaldehyde (PubChem CID 66148273) has the molecular formula C11H8ClNOS2 and a molecular weight of 269.78 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)sulfanylmethyl]-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-[(3-chlorophenyl)sulfanylmethyl]-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 66148273 |
| Molecular Formula | C11H8ClNOS2 |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | 2-[(3-chlorophenyl)sulfanylmethyl]-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1csc(CSc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C11H8ClNOS2/c12-8-2-1-3-10(4-8)15-7-11-13-9(5-14)6-16-11/h1-6H,7H2 |
| InChIKey | MAVULYZWKAHHQL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|