C9H7ClN2S — CID 83159119
4-chloro-2-(pyridin-4-ylmethyl)-1,3-thiazole (PubChem CID 83159119) has the molecular formula C9H7ClN2S and a molecular weight of 210.69 g/mol. Its IUPAC name is 4-chloro-2-(pyridin-4-ylmethyl)-1,3-thiazole.
| Compound Name | 4-chloro-2-(pyridin-4-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 83159119 |
| Molecular Formula | C9H7ClN2S |
| Molecular Weight | 210.69 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 4-chloro-2-(pyridin-4-ylmethyl)-1,3-thiazole |
| SMILES | Clc1csc(Cc2ccncc2)n1 |
| InChI | InChI=1S/C9H7ClN2S/c10-8-6-13-9(12-8)5-7-1-3-11-4-2-7/h1-4,6H,5H2 |
| InChIKey | JIEDWECWXACHER-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |