C6H6ClNOS — CID 147334896
1-(4-chloro-1,3-thiazol-2-yl)propan-2-one (PubChem CID 147334896) has the molecular formula C6H6ClNOS and a molecular weight of 175.64 g/mol. Its IUPAC name is 1-(4-chloro-1,3-thiazol-2-yl)propan-2-one.
| Compound Name | 1-(4-chloro-1,3-thiazol-2-yl)propan-2-one |
|---|---|
| PubChem CID | 147334896 |
| Molecular Formula | C6H6ClNOS |
| Molecular Weight | 175.64 g/mol |
| Exact Mass | 174.99 |
| IUPAC Name | 1-(4-chloro-1,3-thiazol-2-yl)propan-2-one |
| SMILES | CC(=O)Cc1nc(Cl)cs1 |
| InChI | InChI=1S/C6H6ClNOS/c1-4(9)2-6-8-5(7)3-10-6/h3H,2H2,1H3 |
| InChIKey | DCJGPVYGTXSISF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.64 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |