C11H14ClNO4S — CID 69261694
2-[(4-chloro-1,3-thiazol-2-yl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid (PubChem CID 69261694) has the molecular formula C11H14ClNO4S and a molecular weight of 291.76 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-thiazol-2-yl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid.
| Compound Name | 2-[(4-chloro-1,3-thiazol-2-yl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 69261694 |
| Molecular Formula | C11H14ClNO4S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-[(4-chloro-1,3-thiazol-2-yl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)C(Cc1nc(Cl)cs1)C(=O)O |
| InChI | InChI=1S/C11H14ClNO4S/c1-11(2,3)17-10(16)6(9(14)15)4-8-13-7(12)5-18-8/h5-6H,4H2,1-3H3,(H,14,15) |
| InChIKey | LGWKIFLNBVLRCE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|