C11H12ClN3OS — CID 162391934
N-[[2-(2-pyridin-4-ylethyl)-1,3-thiazol-4-yl]methylidene]hydroxylamine;hydrochloride (PubChem CID 162391934) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is N-[[2-(2-pyridin-4-ylethyl)-1,3-thiazol-4-yl]methylidene]hydroxylamine;hydrochloride.
| Compound Name | N-[[2-(2-pyridin-4-ylethyl)-1,3-thiazol-4-yl]methylidene]hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 162391934 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | N-[[2-(2-pyridin-4-ylethyl)-1,3-thiazol-4-yl]methylidene]hydroxylamine;hydrochloride |
| SMILES | Cl.ON=Cc1csc(CCc2ccncc2)n1 |
| InChI | InChI=1S/C11H11N3OS.ClH/c15-13-7-10-8-16-11(14-10)2-1-9-3-5-12-6-4-9;/h3-8,15H,1-2H2;1H |
| InChIKey | NHBAKSSCBZEFKQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|