C8H8BrClFNO — CID 167454277
5-amino-7-bromo-3-chloro-6-fluoro-3-methylcyclohepta-1,4,6-trien-1-ol (PubChem CID 167454277) has the molecular formula C8H8BrClFNO and a molecular weight of 268.51 g/mol. Its IUPAC name is 5-amino-7-bromo-3-chloro-6-fluoro-3-methylcyclohepta-1,4,6-trien-1-ol.
| Compound Name | 5-amino-7-bromo-3-chloro-6-fluoro-3-methylcyclohepta-1,4,6-trien-1-ol |
|---|---|
| PubChem CID | 167454277 |
| Molecular Formula | C8H8BrClFNO |
| Molecular Weight | 268.51 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | 5-amino-7-bromo-3-chloro-6-fluoro-3-methylcyclohepta-1,4,6-trien-1-ol |
| SMILES | CC1(Cl)C=C(N)C(F)=C(Br)C(O)=C1 |
| InChI | InChI=1S/C8H8BrClFNO/c1-8(10)2-4(12)7(11)6(9)5(13)3-8/h2-3,13H,12H2,1H3 |
| InChIKey | FMGNVDDJFCKZMN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|