C4H4Cl4N2 — CID 177307720
3,3,4,4-tetrachlorocyclobutene-1,2-diamine (PubChem CID 177307720) has the molecular formula C4H4Cl4N2 and a molecular weight of 221.90 g/mol. Its IUPAC name is 3,3,4,4-tetrachlorocyclobutene-1,2-diamine.
| Compound Name | 3,3,4,4-tetrachlorocyclobutene-1,2-diamine |
|---|---|
| PubChem CID | 177307720 |
| Molecular Formula | C4H4Cl4N2 |
| Molecular Weight | 221.90 g/mol |
| Exact Mass | 219.91 |
| IUPAC Name | 3,3,4,4-tetrachlorocyclobutene-1,2-diamine |
| SMILES | NC1=C(N)C(Cl)(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C4H4Cl4N2/c5-3(6)1(9)2(10)4(3,7)8/h9-10H2 |
| InChIKey | UMAJNQRNRRPYKT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.90 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|