C8H10Cl2O — CID 534207
5,5-dichloro-6,6-dimethylspiro[2.3]hexan-4-one (PubChem CID 534207) has the molecular formula C8H10Cl2O and a molecular weight of 193.07 g/mol. Its IUPAC name is 5,5-dichloro-6,6-dimethylspiro[2.3]hexan-4-one.
| Compound Name | 5,5-dichloro-6,6-dimethylspiro[2.3]hexan-4-one |
|---|---|
| PubChem CID | 534207 |
| Molecular Formula | C8H10Cl2O |
| Molecular Weight | 193.07 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | 5,5-dichloro-6,6-dimethylspiro[2.3]hexan-4-one |
| SMILES | CC1(C)C(Cl)(Cl)C(=O)C12CC2 |
| InChI | InChI=1S/C8H10Cl2O/c1-6(2)7(3-4-7)5(11)8(6,9)10/h3-4H2,1-2H3 |
| InChIKey | HJNNWBWNBUMYDR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.07 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|