C13H7Cl2NOS — CID 167454354
2,5-dichloro-2,3-dihydro-[1]benzofuro[2,3-g][1,3]benzothiazole (PubChem CID 167454354) has the molecular formula C13H7Cl2NOS and a molecular weight of 296.18 g/mol. Its IUPAC name is 2,5-dichloro-2,3-dihydro-[1]benzofuro[2,3-g][1,3]benzothiazole.
| Compound Name | 2,5-dichloro-2,3-dihydro-[1]benzofuro[2,3-g][1,3]benzothiazole |
|---|---|
| PubChem CID | 167454354 |
| Molecular Formula | C13H7Cl2NOS |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 294.96 |
| IUPAC Name | 2,5-dichloro-2,3-dihydro-[1]benzofuro[2,3-g][1,3]benzothiazole |
| SMILES | Clc1cc2c(c3c1oc1ccccc13)SC(Cl)N2 |
| InChI | InChI=1S/C13H7Cl2NOS/c14-7-5-8-12(18-13(15)16-8)10-6-3-1-2-4-9(6)17-11(7)10/h1-5,13,16H |
| InChIKey | WOEFFARJWHDAPB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|