C13H6Cl2OS — CID 57256472
2,4-dichloroxanthene-9-thione (PubChem CID 57256472) has the molecular formula C13H6Cl2OS and a molecular weight of 281.16 g/mol. Its IUPAC name is 2,4-dichloroxanthene-9-thione.
| Compound Name | 2,4-dichloroxanthene-9-thione |
|---|---|
| PubChem CID | 57256472 |
| Molecular Formula | C13H6Cl2OS |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | 2,4-dichloroxanthene-9-thione |
| SMILES | S=c1c2ccccc2oc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C13H6Cl2OS/c14-7-5-9-12(10(15)6-7)16-11-4-2-1-3-8(11)13(9)17/h1-6H |
| InChIKey | UFRJRSGSWAENDN-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|