C14H6ClF2IN2O — CID 167456017
2-(2-chloro-5-iodo-3-pyridinyl)-5,7-difluoro-1H-quinolin-4-one (PubChem CID 167456017) has the molecular formula C14H6ClF2IN2O and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-(2-chloro-5-iodo-3-pyridinyl)-5,7-difluoro-1H-quinolin-4-one.
| Compound Name | 2-(2-chloro-5-iodo-3-pyridinyl)-5,7-difluoro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 167456017 |
| Molecular Formula | C14H6ClF2IN2O |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 417.92 |
| IUPAC Name | 2-(2-chloro-5-iodo-3-pyridinyl)-5,7-difluoro-1H-quinolin-4-one |
| SMILES | O=c1cc(-c2cc(I)cnc2Cl)[nH]c2cc(F)cc(F)c12 |
| InChI | InChI=1S/C14H6ClF2IN2O/c15-14-8(3-7(18)5-19-14)10-4-12(21)13-9(17)1-6(16)2-11(13)20-10/h1-5H,(H,20,21) |
| InChIKey | AGDVWWNIHDZDTP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|