C17H23IN2O3S — CID 167456432
2-[[4-carbamoyl-2-oxo-4-(2-propan-2-ylphenyl)pyrrolidin-1-yl]methoxy]ethyl thiohypoiodite (PubChem CID 167456432) has the molecular formula C17H23IN2O3S and a molecular weight of 462.35 g/mol. Its IUPAC name is 2-[[4-carbamoyl-2-oxo-4-(2-propan-2-ylphenyl)pyrrolidin-1-yl]methoxy]ethyl thiohypoiodite.
| Compound Name | 2-[[4-carbamoyl-2-oxo-4-(2-propan-2-ylphenyl)pyrrolidin-1-yl]methoxy]ethyl thiohypoiodite |
|---|---|
| PubChem CID | 167456432 |
| Molecular Formula | C17H23IN2O3S |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 2-[[4-carbamoyl-2-oxo-4-(2-propan-2-ylphenyl)pyrrolidin-1-yl]methoxy]ethyl thiohypoiodite |
| SMILES | CC(C)c1ccccc1C1(C(N)=O)CC(=O)N(COCCSI)C1 |
| InChI | InChI=1S/C17H23IN2O3S/c1-12(2)13-5-3-4-6-14(13)17(16(19)22)9-15(21)20(10-17)11-23-7-8-24-18/h3-6,12H,7-11H2,1-2H3,(H2,19,22) |
| InChIKey | AFBHVIBDJWAQBF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|