C21H29N3O3 — CID 167456812
1-[2,6-di(propan-2-yloxy)-3-pyridinyl]-3-(2-propan-2-ylphenyl)urea (PubChem CID 167456812) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yloxy)-3-pyridinyl]-3-(2-propan-2-ylphenyl)urea.
| Compound Name | 1-[2,6-di(propan-2-yloxy)-3-pyridinyl]-3-(2-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 167456812 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-[2,6-di(propan-2-yloxy)-3-pyridinyl]-3-(2-propan-2-ylphenyl)urea |
| SMILES | CC(C)Oc1ccc(NC(=O)Nc2ccccc2C(C)C)c(OC(C)C)n1 |
| InChI | InChI=1S/C21H29N3O3/c1-13(2)16-9-7-8-10-17(16)22-21(25)23-18-11-12-19(26-14(3)4)24-20(18)27-15(5)6/h7-15H,1-6H3,(H2,22,23,25) |
| InChIKey | DEVHRFATFZIYRM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |