C23H34FN3O3 — CID 167456640
1-[2-(2-fluoroethoxy)-6-methoxy-3-pyridinyl]-3-(2-propan-2-ylphenyl)urea;pentane (PubChem CID 167456640) has the molecular formula C23H34FN3O3 and a molecular weight of 419.54 g/mol. Its IUPAC name is 1-[2-(2-fluoroethoxy)-6-methoxy-3-pyridinyl]-3-(2-propan-2-ylphenyl)urea;pentane.
| Compound Name | 1-[2-(2-fluoroethoxy)-6-methoxy-3-pyridinyl]-3-(2-propan-2-ylphenyl)urea;pentane |
|---|---|
| PubChem CID | 167456640 |
| Molecular Formula | C23H34FN3O3 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 1-[2-(2-fluoroethoxy)-6-methoxy-3-pyridinyl]-3-(2-propan-2-ylphenyl)urea;pentane |
| SMILES | CCCCC.COc1ccc(NC(=O)Nc2ccccc2C(C)C)c(OCCF)n1 |
| InChI | InChI=1S/C18H22FN3O3.C5H12/c1-12(2)13-6-4-5-7-14(13)20-18(23)21-15-8-9-16(24-3)22-17(15)25-11-10-19;1-3-5-4-2/h4-9,12H,10-11H2,1-3H3,(H2,20,21,23);3-5H2,1-2H3 |
| InChIKey | SFJOELKIQMFADK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |