About 2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide
2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide (PubChem CID 5224256) has the molecular formula C15H24N2O5
and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide.
Molecular Properties
| Compound Name | 2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide |
| PubChem CID | 5224256 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide |
| SMILES | CCCCOCCOCC(=O)Nc1ccc(OC)nc1OC |
| InChI | InChI=1S/C15H24N2O5/c1-4-5-8-21-9-10-22-11-13(18)16-12-6-7-14(19-2)17-15(12)20-3/h6-7H,4-5,8-11H2,1-3H3,(H,16,18) |
| InChIKey | GCJNMRLUAPPLPF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide?
The IUPAC name of 2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide (CID 5224256) is 2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide.
What is the SMILES notation for 2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide?
The canonical SMILES for 2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide is CCCCOCCOCC(=O)Nc1ccc(OC)nc1OC.
What is the InChIKey of 2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide?
The InChIKey is GCJNMRLUAPPLPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O5/c1-4-5-8-21-9-10-22-11-13(18)16-12-6-7-14(19-2)17-15(12)20-3/h6-7H,4-5,8-11H2,1-3H3,(H,16,18).
What are the key properties of 2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide?
2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide has a molecular weight of 312.37 g/mol, XLogP of 1.87, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butoxyethoxy)-N-(2,6-dimethoxy-3-pyridinyl)acetamide is sourced from PubChem (CID 5224256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).