C11H20N2S — CID 167458143
3-cyclohexyl-4,4-dimethyl-1,3-thiazolidin-2-imine (PubChem CID 167458143) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is 3-cyclohexyl-4,4-dimethyl-1,3-thiazolidin-2-imine.
| Compound Name | 3-cyclohexyl-4,4-dimethyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 167458143 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-cyclohexyl-4,4-dimethyl-1,3-thiazolidin-2-imine |
| SMILES | [H]/N=C1\SCC(C)(C)N1C1CCCCC1 |
| InChI | InChI=1S/C11H20N2S/c1-11(2)8-14-10(12)13(11)9-6-4-3-5-7-9/h9,12H,3-8H2,1-2H3/b12-10- |
| InChIKey | MSMVXRHTOGKOJZ-BENRWUELSA-N |
| XLogP | 3.08 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|