C28H27N3O2 — CID 16745958
1-[(1R)-1-phenylethyl]-4-(phenylmethoxymethyl)-5-(3-phenylmethoxyprop-1-ynyl)triazole (PubChem CID 16745958) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-[(1R)-1-phenylethyl]-4-(phenylmethoxymethyl)-5-(3-phenylmethoxyprop-1-ynyl)triazole.
| Compound Name | 1-[(1R)-1-phenylethyl]-4-(phenylmethoxymethyl)-5-(3-phenylmethoxyprop-1-ynyl)triazole |
|---|---|
| PubChem CID | 16745958 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 1-[(1R)-1-phenylethyl]-4-(phenylmethoxymethyl)-5-(3-phenylmethoxyprop-1-ynyl)triazole |
| SMILES | C[C@H](c1ccccc1)n1nnc(COCc2ccccc2)c1C#CCOCc1ccccc1 |
| InChI | InChI=1S/C28H27N3O2/c1-23(26-16-9-4-10-17-26)31-28(18-11-19-32-20-24-12-5-2-6-13-24)27(29-30-31)22-33-21-25-14-7-3-8-15-25/h2-10,12-17,23H,19-22H2,1H3/t23-/m1/s1 |
| InChIKey | DJIFIECNPHKMJV-HSZRJFAPSA-N |
| XLogP | 5.17 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|